A0647556
Allethrin , Analysis standard , 584-79-2
Synonym(s):
Allylcinerine
CAS NO.:584-79-2
Empirical Formula: C19H26O3
Molecular Weight: 302.41
MDL number: MFCD00045443
EINECS: 209-542-4
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB79.20 | In Stock |
|
| 100mg | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | approximate 4℃ |
| Boiling point: | 160°C |
| Density | 1.01 |
| vapor pressure | 1.6×10-4 Pa (21 °C) |
| refractive index | nD20 1.5040; nD30 1.5023 |
| Flash point: | 66 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform: Slightly Soluble |
| Water Solubility | 2 mg l-1 |
| form | Viscous Liquid |
| color | Clear amber |
| BRN | 2294836 |
| InChI | 1S/C19H26O3/c1-7-8-13-12(4)16(10-15(13)20)22-18(21)17-14(9-11(2)3)19(17,5)6/h7,9,14,16-17H,1,8,10H2,2-6H3 |
| InChIKey | ZCVAOQKBXKSDMS-UHFFFAOYSA-N |
| SMILES | C\C(C)=C\[C@@H]1[C@@H](C(=O)O[C@H]2CC(=O)C(CC=C)=C2C)C1(C)C |
| LogP | 4.780 |
| CAS DataBase Reference | 584-79-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Bioallethrin(584-79-2) |
| EPA Substance Registry System | Allethrin (584-79-2) |
Description and Uses
Allethrin is a synthetic pyrethroid derivative used as an insecticide. Allethrin is commonly used in many household insecticide products due to its low toxicity towards humans.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H410 |
| Precautionary statements | P273-P301+P312+P330-P304+P340+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 20/22-50/53-40 |
| Safety Statements | 36-60-61-36/37-24/25-23 |
| RIDADR | UN 3082 |
| WGK Germany | 3 |
| RTECS | GZ1925000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29183000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 584-79-2(Hazardous Substances Data) |
| Toxicity | LD50 oral in rabbit: 4290mg/kg |








