Allethrin , Analysis standard , 584-79-2
Synonym(s):
Allylcinerine
CAS NO.:584-79-2
Empirical Formula: C19H26O3
Molecular Weight: 302.41
MDL number: MFCD00045443
EINECS: 209-542-4
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB79.20 | In Stock |
|
| 100mg | RMB159.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | approximate 4℃ |
| Boiling point: | 160°C |
| Density | 1.01 |
| vapor pressure | 1.6×10-4 Pa (21 °C) |
| refractive index | nD20 1.5040; nD30 1.5023 |
| Flash point: | 66 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform: Slightly Soluble |
| Water Solubility | 2 mg l-1 |
| form | Viscous Liquid |
| color | Clear amber |
| BRN | 2294836 |
| Henry's Law Constant | 6.0×101 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| Exposure limits | PC-TWA: 5 mg/m3 |
| InChI | 1S/C19H26O3/c1-7-8-13-12(4)16(10-15(13)20)22-18(21)17-14(9-11(2)3)19(17,5)6/h7,9,14,16-17H,1,8,10H2,2-6H3 |
| InChIKey | ZCVAOQKBXKSDMS-UHFFFAOYSA-N |
| SMILES | C\C(C)=C\[C@@H]1[C@@H](C(=O)O[C@H]2CC(=O)C(CC=C)=C2C)C1(C)C |
| LogP | 4.780 |
| CAS DataBase Reference | 584-79-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Bioallethrin(584-79-2) |
| EPA Substance Registry System | Allethrin (584-79-2) |
Description and Uses
Allethrin is a pyrethroid insecticide mostly used in amenity and domestic situations. It has a low aqueous solubility, is volatile and, based on its chemical properties, would not be expected to leach to groundwater. It tends to be moderately persistent in most soil systems. Allethrin is moderately toxic to mammals and a recognised irritant. Whilst it is not highly toxic to birds it is moderately toxic to fish, honeybees and earthworms.
Allethrin is a synthetic pyrethroid derivative used as an insecticide. Allethrin is commonly used in many household insecticide products due to its low toxicity towards humans.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H410 |
| Precautionary statements | P273-P301+P312+P330-P304+P340+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 20/22-50/53-40 |
| Safety Statements | 36-60-61-36/37-24/25-23 |
| RIDADR | UN 3082 |
| WGK Germany | 3 |
| RTECS | GZ1925000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29183000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 584-79-2(Hazardous Substances Data) |
| Toxicity | LD50 oral in rabbit: 4290mg/kg |








