A0648812
1-Adamantanecarboxylic acid , 98% , 828-51-3
CAS NO.:828-51-3
Empirical Formula: C11H16O2
Molecular Weight: 180.24
MDL number: MFCD00074720
EINECS: 212-584-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB33.60 | In Stock |
|
| 100G | RMB111.20 | In Stock |
|
| 250g | RMB263.20 | In Stock |
|
| 500G | RMB503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-174 °C (lit.) |
| Boiling point: | 253.08°C (rough estimate) |
| Density | 0.9976 (rough estimate) |
| refractive index | 1.4910 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 4.86±0.20(Predicted) |
| color | White to off-white |
| Water Solubility | Insoluble in water. Solubility in methanol gives very faint turbidity. Soluble in ethanol, chloroform, and dichloromethane. |
| BRN | 1910637 |
| InChI | InChI=1S/C11H16O2/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H,12,13) |
| InChIKey | JIMXXGFJRDUSRO-UHFFFAOYSA-N |
| SMILES | C12(C(O)=O)CC3CC(CC(C3)C1)C2 |
| CAS DataBase Reference | 828-51-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Adamantane-1-carboxylic acid(828-51-3) |
Description and Uses
1-Adamantanecarboxylic acid can be used as:
- A stabilizer in the synthesis of monodisperse, highly crystalline CoPt3?nanoparticles and porous platinum nanoparticles.
- An additive in polycondensation reactions to yield conjugated polymers as possible optoelectronic materials.
- An additive in the allylic substitution reaction, which is catalyzed by palladium in an aqueous medium.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | AU4452200 |
| Hazard Note | Irritant |
| HS Code | 29162000 |
| Storage Class | 11 - Combustible Solids |





