A0653812
4-Allyloxy-2-hydroxybenzophenone , 99% , 2549-87-3
Synonym(s):
2-Hydroxy-4-allyloxybenzophenone
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB258.40 | In Stock |
|
| 500G | RMB722.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-70 °C (lit.) |
| Boiling point: | 178°C/1mmHg(lit.) |
| Density | 1.165±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 7.63±0.35(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C16H14O3/c1-2-10-19-13-8-9-14(15(17)11-13)16(18)12-6-4-3-5-7-12/h2-9,11,17H,1,10H2 |
| InChIKey | GVZIBGFELWPEOC-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OCC=C)C=C1O)(C1=CC=CC=C1)=O |
| EPA Substance Registry System | Methanone, [2-hydroxy-4-(2-propenyloxy)phenyl]phenyl- (2549-87-3) |
Description and Uses
Copolymerizable UV absorber
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



