A0656412
L-Asparagine Monohydrate , 99% , 5794-13-8
Synonym(s):
L-Asparagine monohydrate;Asparagine Monohydrate;Asparaginic acid semiamide, Asn;(S)-(+)-2-Aminosuccinamic acid;(S)-2-Aminosuccinic acid 4-amide
CAS NO.:5794-13-8
Empirical Formula: C4H10N2O4
Molecular Weight: 150.13
MDL number: MFCD00151038
EINECS: 611-593-6
| Pack Size | Price | Stock | Quantity |
| 10G | RMB23.20 | In Stock |
|
| 25G | RMB27.20 | In Stock |
|
| 100G | RMB44.80 | In Stock |
|
| 500G | RMB128.80 | In Stock |
|
| 2.5KG | RMB540.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233-235 °C(lit.) |
| alpha | 35 º (c=10, 6N HCl) |
| Boiling point: | 271.66°C (rough estimate) |
| Density | 1,543 g/cm3 |
| bulk density | 530kg/m3 |
| refractive index | 31 ° (C=10, HCl) |
| storage temp. | 2-8°C |
| solubility | H2O: 20 mg/mL |
| form | powder |
| color | White to Off-white |
| PH | 4.0-5.5 (20g/l, H2O, 20℃) |
| Odor | at 100.00?%. odorless |
| biological source | synthetic |
| optical activity | [α]20/D 33.0 to 36.3 °, c =10 in 6 M HCl |
| Water Solubility | 30 g/L (20 ºC) |
| Merck | 14,837 |
| BRN | 5767869 |
| InChI | 1S/C4H8N2O3.H2O/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H2,6,7)(H,8,9);1H2/t2-;/m0./s1 |
| InChIKey | RBMGJIZCEWRQES-DKWTVANSSA-N |
| SMILES | [H]O[H].N[C@@H](CC(N)=O)C(O)=O |
| LogP | -1.506 (est) |
| CAS DataBase Reference | 5794-13-8(CAS DataBase Reference) |
Description and Uses
L-Asparagine is a naturally occurring proteinogenic amino acid, used in biomanufacturing cell culture systems for the production of therapeutic recombinant proteins and monoclonal antibodies. It is used in the biosynthesis of proteins. It is also required for development and function of the brain.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | Y |
| HS Code | 29241900 |
| Storage Class | 11 - Combustible Solids |





