A0657612
Aniline sulfate , AR,99.0% , 542-16-5
CAS NO.:542-16-5
Empirical Formula: C12H16N2O4S
Molecular Weight: 284.33
MDL number: MFCD00013110
EINECS: 208-805-0
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.38 |
| solubility | water: soluble5%, clear, colorless |
| form | powder |
| color | Nearly white |
| Water Solubility | Soluble in water |
| BRN | 3729533 |
| InChI | 1S/2C6H7N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5H,7H2;(H2,1,2,3,4) |
| InChIKey | FUKMEFZGEMVGLD-UHFFFAOYSA-N |
| SMILES | OS(O)(=O)=O.Nc1ccccc1.Nc2ccccc2 |
| CAS DataBase Reference | 542-16-5(CAS DataBase Reference) |
| EPA Substance Registry System | Aniline sulfate (542-16-5) |
Description and Uses
Aniline sulfate was used as an internal standard in the stereoselective disposition of methamphetamine (MAP, a widely abused drug) study.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H317-H318-H341-H351-H372-H410-H301-H311-H331-H400 |
| Precautionary statements | P273-P304+P340-P305+P351+P338-P310-P361-P260-P280-P302+P352+P312-P304+P340+P312-P305+P351+P338+P310 |
| Hazard Codes | T,N |
| Risk Statements | 23/24/25-40-41-43-48/23/24/25-50-68 |
| Safety Statements | 26-27-36/37/39-45-61-63 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Dam. 1 Muta. 2 Skin Sens. 1 STOT RE 1 |










