A0661050
2-(4-Aminophenyl)benzoxazol-5-amine , ≥98% , 13676-47-6
CAS NO.:13676-47-6
Empirical Formula: C13H11N3O
Molecular Weight: 225.25
MDL number: MFCD00445970
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB84.80 | In Stock |
|
| 25g | RMB356.80 | In Stock |
|
| 100g | RMB1423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 231-233°C |
| Boiling point: | 435.2±25.0 °C(Predicted) |
| Density | 1.329 |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 7.49±0.10(Predicted) |
| color | Off-White to Tan |
| λmax | 310(Heptan) nm |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C13H11N3O/c14-9-3-1-8(2-4-9)13-16-11-7-10(15)5-6-12(11)17-13/h1-7H,14-15H2 |
| InChIKey | UMGYJGHIMRFYSP-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(N)C=C2N=C1C1=CC=C(N)C=C1 |
| CAS DataBase Reference | 13676-47-6 |
Description and Uses
2-(3-Amino-phenyl)-benzooxazol-5-ylamine can be used to prepare high-strength flexible transparent polyimide materials.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H341 |
| Precautionary statements | P501-P202-P201-P264-P280-P302+P352-P308+P313-P337+P313-P305+P351+P338-P362+P364-P332+P313-P405 |
| HS Code | 2934.99.4400 |



