A0662350
1-hexadecyl-3-methylimidazoliumbromide , 99% , 132361-22-9
CAS NO.:132361-22-9
Empirical Formula: C20H39N2.Br
Molecular Weight: 387.441
MDL number: MFCD19442853
EINECS: 200-145-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB75.20 | In Stock |
|
| 25g | RMB207.20 | In Stock |
|
| 100g | RMB587.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C20H39N2.BrH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19-18-21(2)20-22;/h18-20H,3-17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QPERNWXRUSFVPU-UHFFFAOYSA-M |
| SMILES | C1N(CCCCCCCCCCCCCCCC)C=C[N+]=1C.[Br-] |
Description and Uses
1-hexadecyl-3-methylimidazolium bromide is an imidazolium-based ionic liquid that can be used as an effective corrosion inhibitor and extractant. In acidic environments, it adsorbs onto the surface of metals (such as low-carbon steel) to form a protective barrier, significantly slowing down the rate of metal corrosion [1]. In aqueous solutions, it forms aggregates that effectively dissolve and extract hydrophobic organic compounds (such as polycyclic aromatic hydrocarbons) [2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29332900 |






