A3935412
1-Ethyl-3-methylimidazolium Trifluoromethanesulfonate , 98% , 145022-44-2
Synonym(s):
[EMIM][TRIFLATE];1-Ethyl-3-methylimidazolium trifluoromethanesulfonate;EMIM Otf
CAS NO.:145022-44-2
Empirical Formula: C7H11F3N2O3S
Molecular Weight: 260.23
MDL number: MFCD00210008
EINECS: 680-002-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB97.60 | In Stock |
|
| 25G | RMB424.80 | In Stock |
|
| 100G | RMB1227.20 | In Stock |
|
| 500g | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -12°C |
| Boiling point: | >350 °C (lit.) |
| Density | 1.387 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C6H11N2.CHF3O3S/c1-3-8-5-4-7(2)6-8;2-1(3,4)8(5,6)7/h4-6H,3H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ZPTRYWVRCNOTAS-UHFFFAOYSA-M |
| SMILES | N1(CC)C=C[N+](C)=C1.C(F)(F)(F)S([O-])(=O)=O |
| LogP | -2.5--2.2 at 23℃ and pH6.8 |
| CAS DataBase Reference | 145022-44-2(CAS DataBase Reference) |
| ECW | 3.9 V |
Description and Uses
1-Ethyl-3-methylimidazolium trifluoromethanesulfonate may be used as a solvent to produce ionic polymer-polymer composites (IP2C) and also in lipase-catalyzed enantioselective amine acylation with 4-pentenoic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P280a-P305+P351+P338-P321-P332+P313-P337+P313-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 9-21 |
| HazardClass | IRRITANT |
| HS Code | 29332900 |
| Storage Class | 10 - Combustible liquids |





