A0663412
L-Aspartic acid β-benzyl ester , 98% , 2177-63-1
Synonym(s):
β-Benzyl L -aspartate;L -Aspartic acid 4-benzyl ester
CAS NO.:2177-63-1
Empirical Formula: C11H13NO4
Molecular Weight: 223.23
MDL number: MFCD00037208
EINECS: 218-541-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.80 | In Stock |
|
| 25G | RMB83.20 | In Stock |
|
| 100G | RMB212.80 | In Stock |
|
| 500g | RMB703.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~225 °C (dec.) |
| Boiling point: | 413.1±45.0 °C(Predicted) |
| Density | 1.283±0.06 g/cm3(Predicted) |
| refractive index | 27 ° (C=1, 1mol/L HCl) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 2.16±0.23(Predicted) |
| color | White |
| Water Solubility | Insoluble in water. |
| BRN | 1983183 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H13NO4/c12-9(11(14)15)6-10(13)16-7-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | VGALFAWDSNRXJK-VIFPVBQESA-N |
| SMILES | N[C@@H](CC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 2177-63-1(CAS DataBase Reference) |
Description and Uses
L-Aspartic acid β-benzyl ester is used in the synthesis of peptides with a 1,4-diazepine-2,5-dione ring structure and in development of block copolymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |





