A0665812
Ammonium tetrachloroplatinate , Pt52% , 13820-41-2
Synonym(s):
Platinum(II)-ammonium chloride
CAS NO.:13820-41-2
Empirical Formula: Cl4H4NPt-
Molecular Weight: 354.92
MDL number: MFCD00010885
EINECS: 237-499-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB799.20 | In Stock |
|
| 5G | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140 °C (dec.)(lit.) |
| Density | 2.936 g/mL at 25 °C(lit.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in H2O; insoluble in ethanol |
| form | Crystals |
| Specific Gravity | 2.936 |
| color | Pink |
| Water Solubility | Soluble |
| Sensitive | Hygroscopic |
| Merck | 13,553 |
| Exposure limits | ACGIH: TWA 0.002 mg/m3 NIOSH: IDLH 4 mg/m3; TWA 0.002 mg/m3 |
| InChI | 1S/4ClH.2H3N.Pt/h4*1H;2*1H3;/q;;;;;;+2/p-2 |
| InChIKey | QJIMNDWDOXTTBR-UHFFFAOYSA-L |
| SMILES | [H][N+]([H])([H])[H].[H][N+]([H])([H])[H].Cl[Pt--](Cl)(Cl)Cl |
| CAS DataBase Reference | 13820-41-2(CAS DataBase Reference) |
| EPA Substance Registry System | Platinate(2-), tetrachloro-, ammonium (1:2), (SP-4-1)- (13820-41-2) |
Description and Uses
Ammonium tetrachloroplatinate is a darkrubyred crystalline solid. Molecular weight= 372.96; Specific gravity=2.93; Freezing/Melting point= 140- 150℃.Soluble in water.
Ammonium tetrachloroplatinate(II) is used in spectral analysis standard. It is also used in the preparation of platinum sponge and platinum catalytic agent.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H315-H317-H318-H334 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-38-41-42/43-28 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | 3288 |
| WGK Germany | 1 |
| RTECS | TP1840000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 28439090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 |
| Toxicity | LD50 ipr-mus: 60 mg/kg TXAPA9 49,41,79 |







