A1626850
Ammoniumhexachloroplatinate(IV) , Pt≥43.4% , 16919-58-7
Synonym(s):
Ammonium platinic chloride;Platinum(IV)-ammonium chloride
CAS NO.：16919-58-7
Empirical Formula: Cl6Pt.2H4N
Molecular Weight: 443.88
MDL number: MFCD00010886
EINECS: 240-973-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB719.20 | In Stock |
|
| 5g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | °Cd ec.) |
| Density | 3.07 g/mL at 25 °C(lit.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | insoluble in ethanol |
| form | Powder |
| color | Yellow |
| Specific Gravity | 3.065 |
| Water Solubility | Slightly soluble in water. Insoluble in alcohol, ether and concentrated hydrochloric acid. |
| Sensitive | Hygroscopic |
| Merck | 14,548 |
| Exposure limits | ACGIH: TWA 0.002 mg/m3 NIOSH: IDLH 4 mg/m3; TWA 0.002 mg/m3 |
| Stability: | hygroscopic |
| InChI | InChI=1S/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4 |
| InChIKey | PCCGQTHFYHJATL-UHFFFAOYSA-J |
| SMILES | [Pt-2](Cl)(Cl)(Cl)(Cl)(Cl)Cl.[NH4+].[NH4+] |
| CAS DataBase Reference | 16919-58-7(CAS DataBase Reference) |
| EPA Substance Registry System | Ammonium chloroplatinate (16919-58-7) |
Description and Uses
Platinum plating; manufacture of spongy platinum.
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H317-H318-H334 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | T |
| Risk Statements | 25-41-42/43 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | UN 3288 6.1/PG 3 |
| WGK Germany | 1 |
| RTECS | BP5425000 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| Hazardous Substances Data | 16919-58-7(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 195 mg/kg GTPZAB 21(7),55,77 |
