A0665912
Ammonium hexachloropalladate(IV) , 99.9%metalsbasis,Pd29% , 19168-23-1
Synonym(s):
Palladium(IV)-ammonium chloride
CAS NO.:19168-23-1
Empirical Formula: Cl6H8N2Pd
Molecular Weight: 355.21
MDL number: MFCD00015959
EINECS: 242-854-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB251.20 | In Stock |
|
| 1G | RMB567.20 | In Stock |
|
| 5G | RMB2552.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | °Cd ec.) |
| Density | 2,418 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline |
| color | Red-orange |
| Specific Gravity | 2.418 |
| Water Solubility | slightly soluble |
| Sensitive | Hygroscopic |
| Stability: | hygroscopic |
| InChI | 1S/6ClH.2H3N.Pd/h6*1H;2*1H3;/q;;;;;;;;+4/p-4 |
| InChIKey | LOLIPEAFAJNGJM-UHFFFAOYSA-J |
| SMILES | [NH4+].[NH4+].Cl[Pd--](Cl)(Cl)(Cl)(Cl)Cl |
| CAS DataBase Reference | 19168-23-1(CAS DataBase Reference) |
| EPA Substance Registry System | Palladate(2-), hexachloro-, diammonium, (OC-6-11)- (19168-23-1) |
Description and Uses
Ammonium hexachloropalladate(IV) is used as analytical reagent and as a catalyst in the chemical synthesis. It is also used as raw material and intermediates in organic synthesis and pharmaceutical field. Further, it is used in emission spectrographic analysis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/38-36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 3288 |
| WGK Germany | 3 |
| RTECS | BP5390000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity | skn-rbt 100 mg/24H SEV AEHLAU 30,168,75 |





