A0699912
Ammonium chloroiride , .. Content: 43.0% , 16940-92-4
Synonym(s):
Iridium(IV)-ammonium chloride
CAS NO.:16940-92-4
Empirical Formula: Cl6H4IrN-
Molecular Weight: 422.96
MDL number: MFCD00010881
EINECS: 241-007-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB933.60 | In Stock |
|
| 1G | RMB2157.60 | In Stock |
|
| 5G | RMB8829.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | decomposes [STR93] |
| Density | 2.86 g/mL at 25 °C(lit.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| Specific Gravity | 2.856 |
| color | Red-black |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Stability: | hygroscopic |
| InChI | InChI=1S/6ClH.Ir.H3N/h6*1H;;1H3/q;;;;;;+4;/p-5 |
| InChIKey | BTQOTBAATRYXPP-UHFFFAOYSA-I |
| SMILES | [Ir+4]([Cl-])([Cl-])([Cl-])([Cl-])([Cl-])[Cl-].[NH4+] |
| CAS DataBase Reference | 16940-92-4(CAS DataBase Reference) |
| EPA Substance Registry System | Iridate(2-), hexachloro-, diammonium, (OC-6-11)- (16940-92-4) |
Description and Uses
Iridium complexes are generated from ammonium hexachloroiridate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 36/38-22-20/21/22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | BP5295000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| Toxicity | rat,LD50,oral,1852mg/kg (1852mg/kg),Gigiena Truda i Professional'nye Zabolevaniya. Labor Hygiene and Occupational Diseases. Vol. 21(7), Pg. 55, 1977. |






