A0666412
N-Acetyl-L-glutamic acid , 99% , 1188-37-0
CAS NO.：1188-37-0
Empirical Formula: C7H11NO5
Molecular Weight: 189.17
MDL number: MFCD00002802
EINECS: 214-708-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB54.40 | In Stock |
|
| 100G | RMB129.60 | In Stock |
|
| 500G | RMB574.40 | In Stock |
|
| 2.5kg | RMB2073.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-196 °C(lit.) |
| alpha | -16 º (c=1, water) |
| Boiling point: | 324.41°C (rough estimate) |
| Density | 1.4119 (rough estimate) |
| refractive index | -15 ° (C=1, H2O) |
| FEMA | 4752 | N-ACETYL GLUTAMATE |
| storage temp. | 2-8°C |
| solubility | 36g/l (Lit.) |
| pka | 3.45±0.10(Predicted) |
| form | Solid |
| color | White |
| optical activity | [α]22/D 15.6°, c = 1 in H2O |
| Water Solubility | 2.7 g/100 mL (20 ºC) |
| JECFA Number | 2269 |
| BRN | 1727473 |
| Major Application | peptide synthesis |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| Cosmetic Ingredient Review (CIR) | N-Acetyl-L-glutamic acid (1188-37-0) |
| InChI | 1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/t5-/m0/s1 |
| InChIKey | RFMMMVDNIPUKGG-YFKPBYRVSA-N |
| SMILES | CC(=O)N[C@@H](CCC(O)=O)C(O)=O |
| LogP | -2.131 (est) |
| CAS DataBase Reference | 1188-37-0(CAS DataBase Reference) |
| NIST Chemistry Reference | N-acetyl-l-glutamic acid(1188-37-0) |
| EPA Substance Registry System | L-Glutamic acid, N-acetyl- (1188-37-0) |
Description and Uses
Substrate for acetylglutamate kinase. Inhibitor of N-acetyl-L-glutamate synthetase
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | LZ9725000 |
| TSCA | TSCA listed |
| HS Code | 29241900 |
| Storage Class | 11 - Combustible Solids |
