A0670712
                    (-)-Arctigenin , ≥98%(HPLC) , 7770-78-7
                            Synonym(s):
(−)-Arctigenin;(3R,4R)-4-[(3,4-Dimethoxyphenyl)methyl]dihydro-3-[(4-hydroxy-3-methoxyphenyl)methyl]-2(3H)-furanone;2(3H)-Furanone
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 50MG | RMB209.60 | In Stock | 
                                                 | 
                                        
| 250mg | RMB775.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 98.0 to 102.0 °C | 
                                    
| Boiling point: | 567.0±45.0 °C(Predicted) | 
                                    
| Density | 1.227±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Sealed in dry,Store in freezer, under -20°C | 
                                    
| solubility | DMSO: 34 mg/mL with heating and sonicating, soluble | 
                                    
| form | solid | 
                                    
| pka | 10.03±0.20(Predicted) | 
                                    
| color | White to Light yellow | 
                                    
| λmax | 280nm(EtOH)(lit.) | 
                                    
| InChI | InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1 | 
                                    
| InChIKey | NQWVSMVXKMHKTF-JKSUJKDBSA-N | 
                                    
| SMILES | O1C[C@H](CC2=CC=C(OC)C(OC)=C2)[C@@H](CC2=CC=C(O)C(OC)=C2)C1=O | 
                                    
| LogP | 2.470 (est) | 
                                    
| CAS DataBase Reference | 7770-78-7(CAS DataBase Reference) | 
                                    
Description and Uses
Arctigenin is a plant ligan associated with anticancer and antioxidant properties.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| Safety Statements | 22-24/25 | 
| WGK Germany | 3 | 
| RTECS | LY9247000 | 
| HS Code | 2932.20.4500 | 



