A0674512
Azocyclotin , Analysis standard , 41083-11-8
CAS NO.:41083-11-8
Empirical Formula: C20H35N3Sn
Molecular Weight: 436.22
MDL number: MFCD00055290
EINECS: 255-209-1
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210℃ |
| Boiling point: | 487.4±28.0 °C(Predicted) |
| vapor pressure | 2×10-11 Pa (20 °C, est.) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 5.36 (weak base) |
| Water Solubility | 0.12 mg l-1 (20 °C) |
| BRN | 621636 |
| Henry's Law Constant | 4.6×106 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| InChI | InChI=1S/3C6H11.C2H2N3.Sn/c3*1-2-4-6-5-3-1;1-3-2-5-4-1;/h3*1H,2-6H2;1-2H;/q;;;-1;+1 |
| InChIKey | ONHBDDJJTDTLIR-UHFFFAOYSA-N |
| SMILES | N1([Sn](C2CCCCC2)(C2CCCCC2)C2CCCCC2)C=NC=N1 |
| CAS DataBase Reference | 41083-11-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-1,2,4-triazole, 1-(tricyclohexylstannyl)-(41083-11-8) |
| EPA Substance Registry System | Azocyclotin (41083-11-8) |
Description and Uses
Azocyclotin is used to control all motile stages of spider mites on fruit, vines, hops, cotton, vegetables and ornamentals.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H330-H335-H410 |
| Precautionary statements | P264-P270-P280-P260-P271-P284-P261-P273-P301+P310-P330-P302+P352-P332+P313-P362+P364-P305+P351+P338-P310-P304+P340-P312-P391-P405-P403+P233-P501 |
| Hazard Codes | T+;N,N,T+ |
| Risk Statements | 25-26-37/38-41-50/53 |
| Safety Statements | 26-28-36/37/39-38-45-60-61 |
| RIDADR | UN 2786 |
| WGK Germany | 3 |
| RTECS | WH8637700 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| Hazardous Substances Data | 41083-11-8(Hazardous Substances Data) |








