A0674812
N-(4-Aminobutyl)-N-ethylisoluminol , 97% , 66612-29-1
Synonym(s):
4-(N1-Ethyl-4-aminobutylamino)phthalic hydrazide;6-[N-(4-Aminobutyl)-N-ethylamino]-2,3-dihydro-1,4-phthalazinedione;ABEI
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB638.40 | In Stock |
|
| 500MG | RMB2288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 259-260 °C (lit.) |
| Density | 1.206±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | glacial acetic acid: 50mg/mL, clear, colorless to yellow |
| form | powder to crystal |
| pka | 10.83±0.20(Predicted) |
| color | White to Light yellow |
| BRN | 920895 |
| InChI | 1S/C14H20N4O2/c1-2-18(8-4-3-7-15)10-5-6-11-12(9-10)14(20)17-16-13(11)19/h5-6,9H,2-4,7-8,15H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | LEOJISUPFSWNMA-UHFFFAOYSA-N |
| SMILES | CCN(CCCCN)c1ccc2C(=O)NNC(=O)c2c1 |
| CAS DataBase Reference | 66612-29-1(CAS DataBase Reference) |
Description and Uses
ABEI is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
