A0677756
1-Ethyl-3-methylimidazoliumbis(trifluoromethylsulfonyl)imide , 99% , 174899-82-2
Synonym(s):
1-Ethyl-3-methyl-1-H-imidazolium bis(trifluoromethansulfonyl)imide;1-Ethyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide;EMIM BTI;EMIM TFSI;EMIMIm
CAS NO.:174899-82-2
Empirical Formula: C6H11N2.C2F6NO4S2
Molecular Weight: 391.312
MDL number: MFCD03788927
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB319.20 | In Stock |
|
| 5g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥?15 °C (lit.) |
| Boiling point: | 543.6 °C |
| Density | 1,53 g/cm3 |
| vapor pressure | 0.004-0.007Pa at 140.9-150.9℃ |
| refractive index | 1.4220-1.4260 |
| Flash point: | >200 ºC |
| storage temp. | Store below +30°C. |
| Water Solubility | Insoluble in water |
| form | liquid |
| Specific Gravity | 1.53 |
| color | colorless to pale yellow |
| InChI | InChI=1S/C6H11N2.C2F6NO4S2/c1-3-8-5-4-7(2)6-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-6H,3H2,1-2H3;/q+1;-1 |
| InChIKey | LRESCJAINPKJTO-UHFFFAOYSA-N |
| SMILES | [N-](S(C(F)(F)F)(=O)=O)S(=O)(=O)C(F)(F)F.N1(CC)C=C[N+](C)=C1 |
| LogP | -0.73--0.65 at 25℃ and pH6.1 |
| ECW | 4.7 V |
Description and Uses
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310+P330 |
| Hazard Codes | T,N |
| Risk Statements | 24/25-34-51/53 |
| Safety Statements | 26-36/37/39-45-61 |
| RIDADR | UN 2922 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2935 90 90 |
| Toxicity | LD50 orally in Rabbit: > 50 - 300 mg/kg |







