A0681612
N-(4-Aminobenzoyl)-L-glutamic acid , 97% , 4271-30-1
Synonym(s):
N-(4-Aminobenzoyl)-L -glutamic acid;N-(4-aminobenzoyl)-L-Glutamic acid;N-(p-Aminobenzoyl)glutamic acid
CAS NO.:4271-30-1
Empirical Formula: C12H14N2O5
Molecular Weight: 266.25
MDL number: MFCD00042821
EINECS: 224-261-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB124.80 | In Stock |
|
| 100g | RMB392.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~175 °C (dec.) |
| alpha | -15 º (c=2% in 0.1N HCl) |
| Boiling point: | 409.45°C (rough estimate) |
| Density | 1.2846 (rough estimate) |
| refractive index | 1.6660 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Aqueous Base (Sparingly), Aqueous Acid (Sparingly), DMSO (Sparingly) |
| form | Solid |
| pka | 3.50±0.10(Predicted) |
| color | White to Light |
| Merck | 14,426 |
| BRN | 2816320 |
| Stability: | Hygroscopic |
| Major Application | detection peptide synthesis |
| InChI | 1S/C12H14N2O5/c13-8-3-1-7(2-4-8)11(17)14-9(12(18)19)5-6-10(15)16/h1-4,9H,5-6,13H2,(H,14,17)(H,15,16)(H,18,19)/t9-/m0/s1 |
| InChIKey | GADGMZDHLQLZRI-VIFPVBQESA-N |
| SMILES | Nc1ccc(cc1)C(=O)N[C@@H](CCC(O)=O)C(O)=O |
| CAS DataBase Reference | 4271-30-1(CAS DataBase Reference) |
Description and Uses
Major metabolite of 5-Methyltetrahydrofolic Acid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2924296000 |
| Storage Class | 11 - Combustible Solids |




