BD0426445
TetrahydrofolicAcid , 67% , 135-16-0
Synonym(s):
5,6,7,8-Tetrahydropteroyl-L -glutamic acid;THF
CAS NO.：135-16-0
Empirical Formula: C19H23N7O6
Molecular Weight: 445.43
MDL number: MFCD00135583
EINECS: 205-181-1
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB532.80 | In Stock |
|
| 100mg | RMB798.40 | In Stock |
|
| 250mg | RMB1704.00 | In Stock |
|
| 1g | RMB4260.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >162°C (dec.) |
| Boiling point: | 555.12°C (rough estimate) |
| Density | 1.4216 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.6800 (estimate) |
| storage temp. | -20°C |
| solubility | Aqueous Base (Slightly), DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | powder |
| pka | 3.51±0.10(Predicted) |
| color | off-white to tan |
| biological source | synthetic |
| BRN | 9238187 |
| Stability: | We have observed that this material decomposes steadily over time. Use immediately upon receipt. |
| InChIKey | MSTNYGQPCMXVAQ-KIYNQFGBSA-N |
| SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(=O)C1=CC=C(NCC2CNC3=C(N2)C(=O)NC(N)=N3)C=C1 |
| LogP | -3.685 at 25℃ |
Description and Uses
Tetrahydrofolic acid has been used to determine the inhibitory effect of tetrahydrofolate on polymorphonuclear myeloid-derived suppressor cells (PMN-MDSCs). A recent use of tetrahydrofolate (THF) is for studying the activation of riboswitches.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| WGK Germany | 3 |
| RTECS | MA0600800 |
| F | 3-8-10 |
| HS Code | 2936290000 |
