PRODUCT Properties
| Melting point: | 245°C (rough estimate) |
| alpha | D20 +14.26° (c = 3.42 as anhydr Ca salt) |
| Boiling point: | 573.92°C (rough estimate) |
| Density | 1.4485 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO:172.5(Max Conc. mg/mL);364.35(Max Conc. mM) |
| pka | 3.1, 4.8, 10.4(at 25℃) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| Water Solubility | >1350g/L(25 ºC) |
| Stability: | Hygroscopic |
| InChIKey | VVIAGPKUTFNRDU-ABLWVSNPSA-N |
| SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(=O)C1=CC=C(NCC2CNC3=C(N2C=O)C(=O)NC(N)=N3)C=C1 |
| CAS DataBase Reference | 58-05-9(CAS DataBase Reference) |
Description and Uses
Anti-anemic (folate deficiency); antidote (to folic acid antagonists).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazardous Substances Data | 58-05-9(Hazardous Substances Data) |




