PRODUCT Properties
| Melting point: | 106-108 °C |
| alpha | D20 +32.6° (c = 7.6) |
| Boiling point: | 232.96°C (rough estimate) |
| Density | 1.581 |
| refractive index | 1.5860 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly) |
| form | Powder |
| pka | 12.45±0.20(Predicted) |
| color | White to off-white |
| optical activity | [α]/D 33.0±2.0°, c = 0.2 in H2O |
| Merck | 13,319 |
| BRN | 1724621 |
| InChI | 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2 |
| InChIKey | GZCGUPFRVQAUEE-UHFFFAOYSA-N |
| SMILES | OC[C@H]1OC(O)[C@@H](O)[C@H](O)[C@@H]1O |
| LogP | -3.290 (est) |
| CAS DataBase Reference | 1990-29-0(CAS DataBase Reference) |
Description and Uses
D-Altrose is the epimer of D-glucose at C3 and have recently been discovered to possess antioxidant properties by the suppression of reactive oxygen species production in mitochondria due to competiti on with D-glucose at the cellular level.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
