A0697612
Acenaphthenequinone , 98% , 82-86-0
CAS NO.：82-86-0
Empirical Formula: C12H6O2
Molecular Weight: 182.17
MDL number: MFCD00003805
EINECS: 201-441-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB38.40 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB447.20 | In Stock |
|
| 100G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 249-252 °C (dec.) (lit.) |
| Boiling point: | 67 C |
| Density | 1.4800 |
| refractive index | 1.6086 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform |
| form | Powder and Granules |
| color | Ochre |
| Water Solubility | INSOLUBLE |
| BRN | 879172 |
| InChI | InChI=1S/C12H6O2/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)14/h1-6H |
| InChIKey | AFPRJLBZLPBTPZ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2C3C(C=CC=2)=CC=CC=3C1=O |
| CAS DataBase Reference | 82-86-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Acenaphthylenedione(82-86-0) |
| EPA Substance Registry System | 1,2-Acenaphthylenedione (82-86-0) |
Description and Uses
Acenaphthenequinone is used in the preparation of acetylcholinesterase inhibitory agents. It is also used in the preparation of turn-on sensors for cysteine/homocysteine and its application in bioimaging. Further, it is used as an intermediate in manufacturing of dyes and pharmaceuticals. In addition to this, it is used in chemical research as a drug and therapeutic agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 2920 |
| WGK Germany | 3 |
| RTECS | AB1024500 |
| TSCA | Yes |
| HS Code | 29146990 |
| Hazardous Substances Data | 82-86-0(Hazardous Substances Data) |
| Toxicity | LD50 unr-rat: 728 mg/kg RPTOAN 41,146,78 |
