A0699112
L-Alanine isopropyl ester hydrochloride , 98% , 39825-33-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB36.80 | In Stock |
|
| 100G | RMB105.60 | In Stock |
|
| 500g | RMB447.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-91oC |
| Boiling point: | 145.7±13.0 °C(Predicted) |
| Density | 0.968±0.06 g/cm3(Predicted) |
| storage temp. | Store at 0-5°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 8.11±0.29(Predicted) |
| form | Solid |
| color | White |
| Stability: | Very Hygroscopic |
| InChI | InChI=1S/C6H13NO2/c1-4(2)9-6(8)5(3)7/h4-5H,7H2,1-3H3/t5-/m0/s1 |
| InChIKey | QDQVXVRZVCTVHE-YFKPBYRVSA-N |
| SMILES | C(OC(C)C)(=O)[C@H](C)N |
| CAS DataBase Reference | 39825-33-7(CAS DataBase Reference) |
Description and Uses
(S)-Isopropyl-2-aminopropanoate Hydrochloride, is a chemical reagent used in the synthesis of anti-HCV prodrugs based on imidazotriazine and pyrrolotriazine molecules.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H335-H318-H226 |
| Precautionary statements | P280-P305+P351+P338-P310-P264-P280-P302+P352-P321-P332+P313-P362 |
