A0702812
2-Amino-4-methyl-3-nitropyridine , 98% , 6635-86-5
Synonym(s):
2-Amino-3-nitro-4-picoline
CAS NO.:6635-86-5
Empirical Formula: C6H7N3O2
Molecular Weight: 153.14
MDL number: MFCD00006315
EINECS: 626-702-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 25G | RMB131.20 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 100G | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-140 °C(lit.) |
| Boiling point: | 276.04°C (rough estimate) |
| Density | 1.3682 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.97±0.47(Predicted) |
| form | Crystalline Powder |
| color | Yellow |
| BRN | 139111 |
| InChI | InChI=1S/C6H7N3O2/c1-4-2-3-8-6(7)5(4)9(10)11/h2-3H,1H3,(H2,7,8) |
| InChIKey | IKMZGACFMXZAAT-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(C)=C1[N+]([O-])=O |
| CAS DataBase Reference | 6635-86-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 2-amino-3-nitro-4-methyl-(6635-86-5) |
Description and Uses
2-Amino-4-methyl-3-nitropyridine was used in the synthesis of 2-amino-5-hydroxy-4-methyl-3-nitropyridine, 2-amino-4-hydroxymethyl-3-nitropyridine and 2-amino-4-methyl-3-nitropyridine-1-oxide by undergoing biotransformation by Cunninghamella elegans ATCC 26269.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






