A0703212
5-Aminoindazole , 98% , 19335-11-6
CAS NO.：19335-11-6
Empirical Formula: C7H7N3
Molecular Weight: 133.15
MDL number: MFCD00037975
EINECS: 242-971-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5G | RMB113.60 | In Stock |
|
| 25G | RMB492.80 | In Stock |
|
| 100g | RMB1562.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-178 °C (lit.) |
| Boiling point: | 235.67°C (rough estimate) |
| Density | 1.1873 (rough estimate) |
| refractive index | 1.5341 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.52±0.40(Predicted) |
| color | White to Brown |
| BRN | 3259 |
| InChI | InChI=1S/C7H7N3/c8-6-1-2-7-5(3-6)4-9-10-7/h1-4H,8H2,(H,9,10) |
| InChIKey | XBTOSRUBOXQWBO-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(N)C=C2)C=N1 |
| CAS DataBase Reference | 19335-11-6(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Aminoindazole (19335-11-6) |
Description and Uses
5-Amino-1H-indazole is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T,Xn |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36-45-37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NK7711000 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
