A0704412
3-Amino-4-methoxybenzoic acid , 98+% , 2840-26-8
CAS NO.:2840-26-8
Empirical Formula: C8H9NO3
Molecular Weight: 167.16
MDL number: MFCD00002521
EINECS: 220-634-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB140.00 | In Stock |
|
| 25G | RMB483.20 | In Stock |
|
| 100G | RMB1455.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210 °C(lit.) |
| Boiling point: | 295.73°C (rough estimate) |
| Density | 1.2917 (rough estimate) |
| refractive index | 1.5570 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.69±0.10(Predicted) |
| form | powder to crystal |
| color | White to Gray to Brown |
| Water Solubility | Soluble in water. |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H9NO3/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | FDGAEAYZQQCBRN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(OC)C(N)=C1 |
| CAS DataBase Reference | 2840-26-8(CAS DataBase Reference) |
Description and Uses
3-Amino-4-methoxybenzoic Acid is a general reactant/reagent used in the synthesis of VEGFR-2 inhibitors. Also used in the preparation of dihydroisoquinoline compounds as tubulin polymerization inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DG2872000 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





