PRODUCT Properties
| Melting point: | >250°C |
| storage temp. | Amber Vial, Refrigerator |
| solubility | Solubility Soluble in water; slightly soluble in ethanol, acetone |
| Colour Index | 24890 |
| form | powder |
| color | Orange |
| PH Range | Yellow (6.4) to red-orange (8.0) |
| Odor | Odorless |
| Water Solubility | Partially soluble in water |
| ε(extinction coefficient) | ≥37000 at 260-268nm ≥37000 at 486-494nm |
| λmax | 497nm |
| BRN | 4122338 |
| Stability: | Light Sensitve |
| Major Application | Display device, sensors, photochromic materials, inks, detergent, cosmetics, biosensors, assay for enzyme activity, antifungal agent, antiAIDS agent |
| InChIKey | YLDIUICHQPKMNH-MAPAHAHLSA-L |
| SMILES | [Na+].[Na+].Oc1ccc(cc1)\N=N\c2ccc(\C=C\c3ccc(cc3S([O-])(=O)=O)\N=N\c4ccc(O)cc4)c(c2)S([O-])(=O)=O |
| CAS DataBase Reference | 3051-11-4(CAS DataBase Reference) |
| EPA Substance Registry System | C.I. Direct Yellow 4, disodium salt (3051-11-4) |
Description and Uses
Brilliant yellow is an organic diazo dye and a ground water pollutant. Removal processes for brilliant yellow include nanofibrous membrane filtration and nanoplatelet adsorption. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 32041400 |
| Storage Class | 11 - Combustible Solids |







