A0706712
2-Amino-6-chloropurine , 98% , 10310-21-1
Synonym(s):
2-Amino-6-chloropurine;6-Chloro-2-purinamine;6-Chloroguanine
CAS NO.：10310-21-1
Empirical Formula: C5H4ClN5
Molecular Weight: 169.57
MDL number: MFCD00075252
EINECS: 233-686-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 100G | RMB197.60 | In Stock |
|
| 250G | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 279.76°C (rough estimate) |
| Density | 1.4937 (rough estimate) |
| refractive index | 1.6110 (estimate) |
| storage temp. | 2-8°C |
| solubility | Solubility in 1mol/L NaOH |
| pka | 6.65±0.20(Predicted) |
| form | Powder |
| color | White to yellow |
| Water Solubility | 1.7 g/L (20 ºC) |
| BRN | 9626 |
| InChI | InChI=1S/C5H4ClN5/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H3,7,8,9,10,11) |
| InChIKey | RYYIULNRIVUMTQ-UHFFFAOYSA-N |
| SMILES | N1C2C(=NC(N)=NC=2Cl)NC=1 |
| CAS DataBase Reference | 10310-21-1(CAS DataBase Reference) |
| EPA Substance Registry System | 6-Chloro-2-aminopurine (10310-21-1) |
Description and Uses
2-Amino-6-chloropurine is a precursor in the synthesis of nucleoside analogs with antiviral activity against Epstein-Barr virus (EBV) and human herpes virus 6 (HHV-6).
2-Amino-6-chloropurine may be used:
- in the enzymatic synthesis of 2′-deoxyguanosine
- in the synthesis of 9-alkyl purines
- in the synthesis of (R)- and (S)-N-(2-phosphonomethoxypropyl) derivatives of purine and pyrimidine bases
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P201-P202-P261-P264b-P271-P280i-P302+P352-P304+P340-P305+P351+P338-P308+P313-P332+P313-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | UO7502000 |
| F | 10 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29339900 |
