A0707112
4′-Amino-2,3′-dimethylazobenzene , Analysis standard , 97-56-3
Synonym(s):
o-Aminoazotoluene;4′-Amino-2,3′-dimethylazobenzene;Solvent Yellow 3
CAS NO.:97-56-3
Empirical Formula: C14H15N3
Molecular Weight: 225.29
MDL number: MFCD00007733
EINECS: 202-591-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB350.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-102 °C |
| Boiling point: | 356.8°C (rough estimate) |
| Density | 1.1303 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| Colour Index | 11160 |
| pka | 3.01±0.10(Predicted) |
| form | Powder |
| color | Red-brown |
| PH | pH : 1.4~2.8 |
| Water Solubility | 7mg/L(37 ºC) |
| λmax | 491 nm |
| Merck | 14,420 |
| BRN | 6506005 |
| Stability: | Light Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H15N3/c1-10-5-3-4-6-14(10)17-16-12-7-8-13(15)11(2)9-12/h3-9H,15H2,1-2H3/b17-16+ |
| InChIKey | PFRYFZZSECNQOL-WUKNDPDISA-N |
| SMILES | Cc1ccccc1\N=N\c2ccc(N)c(C)c2 |
| CAS DataBase Reference | 97-56-3(CAS DataBase Reference) |
| IARC | 2B (Vol. 8, Sup 7) 1987 |
| NIST Chemistry Reference | Benzenamine, 2-methyl-4-[(2-methylphenyl)azo]-(97-56-3) |
| EPA Substance Registry System | C.I. Solvent Yellow 3 (97-56-3) |
Description and Uses
Coloring oils, fats and waxes; manufacture of pigments. Chemical intermediate for the production of dyes.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H315-H317-H319-H350 |
| Precautionary statements | P201-P202-P280-P301+P310-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 45-22-43-35 |
| Safety Statements | 53-45-36/37/39-26 |
| RIDADR | UN 1789 8/PG 2 |
| WGK Germany | 3 |
| RTECS | XU8800000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| HS Code | 29270000 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 1B Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 97-56-3(Hazardous Substances Data) |
| Toxicity | LD50 oral in dog: 300mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








