PRODUCT Properties
| Melting point: | 216-218°C |
| Boiling point: | 191.38°C (rough estimate) |
| Density | 1.204 |
| refractive index | 1.5110 (estimate) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Sparingly, Sonicated), Methanol (Slightly, Sonicated), Water (Slightly) |
| pka | 13.00±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 13g/L(15 ºC) |
| BRN | 1751301 |
| InChI | InChI=1S/C3H6N2O2/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
| InChIKey | GKRZNOGGALENQJ-UHFFFAOYSA-N |
| SMILES | C(NC(N)=O)(=O)C |
| CAS DataBase Reference | 591-07-1(CAS DataBase Reference) |
| EPA Substance Registry System | Acetamide, N-(aminocarbonyl)- (591-07-1) |
Description and Uses
Acetylurea is used in the preparation Multiple urea derivative compounds which includes glycogen phosphorylase inhibitors
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| Safety Statements | 22-24/25 |
| RTECS | AB4331500 |
| TSCA | TSCA listed |
| HS Code | 2924.19.8000 |






