A0708856
PirimicarbSolutioninMethanol , 1000 μg/mlinmethanol, uncertainty: 2% , 23103-98-2
Synonym(s):
2-Dimethylamino-5,6-dimethyl-4-pyrimidinyl dimethylcarbamate
CAS NO.:23103-98-2
Empirical Formula: C11H18N4O2
Molecular Weight: 238.29
MDL number: MFCD00055520
EINECS: 245-430-1
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90.5°C |
| Boiling point: | 380.88°C (rough estimate) |
| Density | 1.1387 (rough estimate) |
| vapor pressure | 2.1 x 10-3 Pa (30 °C) |
| refractive index | 1.6081 (estimate) |
| Flash point: | >100 °C |
| storage temp. | APPROX 4°C |
| solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.34 (weak base) |
| Water Solubility | 3060 mg l-1 |
| form | Solid |
| color | White to off-white |
| Merck | 13,7579 |
| BRN | 663442 |
| Major Application | agriculture environmental |
| InChI | 1S/C11H18N4O2/c1-7-8(2)12-10(14(3)4)13-9(7)17-11(16)15(5)6/h1-6H3 |
| InChIKey | YFGYUFNIOHWBOB-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Oc1nc(nc(C)c1C)N(C)C |
| LogP | 1.700 |
| CAS DataBase Reference | 23103-98-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Pirimicarb(23103-98-2) |
| EPA Substance Registry System | Pirimicarb (23103-98-2) |
Description and Uses
Pirimicarb is a colorless solid that is
moderately soluble in water, acetone, ethanol, xylene, and
chloroform.
Pirimicarb is produced by reaction of 2-dimethylamino-
5,6-dimethyl-4-pyrimidone with dimethylcarbamic acid
chloride in the presence of a base or phosgene and dimethylamine.
Pirimicarb is a systemic, selective aphicide used
largely on grain crops, but also on ornamentals, cotton,
fruit, and in greenhouses.
Insecticide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H317-H351-H410 |
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T;N,N,T,Xn,F |
| Risk Statements | 25-50/53-36-20/21/22-11 |
| Safety Statements | 22-37-45-60-61-36-26-16-36/37 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | EZ9100000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible, acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Skin Sens. 1 |
| Hazardous Substances Data | 23103-98-2(Hazardous Substances Data) |
| Toxicity | LD50 orally in female rats: 147 (mg/kg) (Baranyovits, Ghosh) |





