PRODUCT Properties
| Melting point: | 190 °C (dec.) (lit.) |
| Boiling point: | 284.68°C (rough estimate) |
| Density | 1.1202 (rough estimate) |
| refractive index | 1.6070 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.97(at 25℃) |
| color | Light Purple to Purple |
| InChI | InChI=1S/C10H9NO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6,12H,11H2 |
| InChIKey | ZBIBQNVRTVLOHQ-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C(N)=CC=C2)=CC=C1 |
| CAS DataBase Reference | 83-55-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Amino-1-naphthol(83-55-6) |
| EPA Substance Registry System | 1-Naphthalenol, 5-amino- (83-55-6) |
Description and Uses
5-Amino-1-naphthol is used as a coupling component for azo dyes (coupling takes place ortho to the amino or hydroxyl group, or para to the hydroxyl group depending on the pH), and as an intermediate for sulfur dyes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
