PRODUCT Properties
| Melting point: | 206-210 °C(lit.) |
| Boiling point: | 284.68°C (rough estimate) |
| Density | 1.1202 (rough estimate) |
| refractive index | 1.6070 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| pka | pK1: 4.20(+1) (25°C) |
| form | Powder or Crystals |
| color | Gray to brown |
| Water Solubility | slightly soluble |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C10H9NO/c11-10-3-1-2-7-4-5-8(12)6-9(7)10/h1-6,12H,11H2 |
| InChIKey | KVHHMYZBFBSVDI-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2N)=CC=C1O |
| CAS DataBase Reference | 118-46-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Naphthalenol, 8-amino- (118-46-7) |
Description and Uses
Sulfonation gives 1-amino-7-hydroxynaphthalene-4-sulfonic acid. The N-acetyl derivative is an important coupling component for after-chrome and metal-complex dyes, e.g., C.I. Mordant Black 38 and C.I. Acid Black 60.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 2 |
| RTECS | QL3331000 |
| TSCA | Yes |
| HS Code | 29222990 |
