A0718812
L-Aspartic acid 4-tert-butyl ester , 98% , 3057-74-7
CAS NO.：3057-74-7
Empirical Formula: C8H15NO4
Molecular Weight: 189.21
MDL number: MFCD00038577
EINECS: 221-292-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB295.20 | In Stock |
|
| 100g | RMB927.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220°C (dec.) |
| Boiling point: | 318.7±37.0 °C(Predicted) |
| Density | 1.162±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Methanol (Slightly), Water (Slightly, Sonicated) |
| form | Solid |
| pka | 2.19±0.23(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D 9±2°, c = 2% in methanol: water (4:1) |
| BRN | 4671089 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H15NO4/c1-8(2,3)13-6(10)4-5(9)7(11)12/h5H,4,9H2,1-3H3,(H,11,12)/t5-/m0/s1 |
| InChIKey | MXWMFBYWXMXRPD-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@H](CC(OC(C)(C)C)=O)N |
| CAS DataBase Reference | 3057-74-7(CAS DataBase Reference) |
Description and Uses
L-Aspartic acid 4-tert-butyl ester is a protected form of L-Aspartic acid (A790024). L-Aspartic acid is a nonessential amino acid that is used to biosynthesize other amino acids within the human body. L-Aspartic acid also increases membrane conductance of mammalian neurons by voltage-dependent means, causing depolarization and nerve impulses that travel to key areas of the central nervous system.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-44-35-28-7-4 |
| WGK Germany | 3 |
| HS Code | 29225090 |
