A7914012
Tris(trimethylsilyl) Phosphate , ≥97.0% , 10497-05-9
Synonym(s):
Phosphoric acid tris(trimethylsilyl ester)
CAS NO.:10497-05-9
Empirical Formula: C9H27O4PSi3
Molecular Weight: 314.54
MDL number: MFCD00008267
EINECS: 234-028-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB204.00 | In Stock |
|
| 100g | RMB584.80 | In Stock |
|
| 500g | RMB2047.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 3-4 °C (lit.) |
| Boiling point: | 228-229 °C/720 mmHg (lit.) |
| Density | 0.945 g/mL at 25 °C (lit.) |
| vapor pressure | 23.3hPa at 20℃ |
| refractive index | n |
| Flash point: | 76 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 23-25(at 25℃) |
| form | liquid |
| Specific Gravity | 0.959 |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 935.5μg/L at 20℃ |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1794624 |
| InChI | 1S/C9H27O4PSi3/c1-15(2,3)11-14(10,12-16(4,5)6)13-17(7,8)9/h1-9H3 |
| InChIKey | QJMMCGKXBZVAEI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| LogP | 4.72 at 20℃ |
| CAS DataBase Reference | 10497-05-9(CAS DataBase Reference) |
| EPA Substance Registry System | Silanol, trimethyl-, phosphate (3:1) (10497-05-9) |
Description and Uses
Tris(trimethylsilyl) phosphite (TMSPi) is a film-forming additive for high voltage cathode material in lithium-ion batteries. Tris (trimethylsilyl) phosphate is cleaved by alkali-metal fluorides, nitrates, and acetates at give the trimethylsilyl esters of the corresponding acids.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 2 |
| RTECS | TC9700000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9010 |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |








