PRODUCT Properties
| Boiling point: | 78-81 °C/8 mmHg (lit.) |
| Density | 0.893 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | RT, stored under nitrogen |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 0.893 |
| Water Solubility | Sparingly soluble in water. |
| Sensitive | Air & Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 2043814 |
| InChI | InChI=1S/C9H27O3PSi3/c1-14(2,3)10-13(11-15(4,5)6)12-16(7,8)9/h1-9H3 |
| InChIKey | VMZOBROUFBEGAR-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(OP(O[Si](C)(C)C)O[Si](C)(C)C)C |
| CAS DataBase Reference | 1795-31-9(CAS DataBase Reference) |
Description and Uses
Tris(trimethylsilyl) Phosphite is used in the studies of bisphosphonic acids as effective inhibitor of glutamine synthetase, a promising approach for the discovery of novel drugs against tuberculosis. It also acts as a reagent in the preparation of substituted calix[4]arenes bearing one or two α-hydroxymethylphosphonic acid fragments at upper rim of macrocycle as inhibitors of glutathione S-transferase in vitro.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| RIDADR | 1760 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319000 |
| REACH Registrations | Active |
