A7977112
Tris(2-butoxyethyl) Phosphate , >95.0%(GC) , 78-51-3
Synonym(s):
Phosphoric acid tris(2-butoxyethyl) ester
CAS NO.:78-51-3
Empirical Formula: C18H39O7P
Molecular Weight: 398.47
MDL number: MFCD00009456
EINECS: 201-122-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB32.80 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 100g | RMB135.20 | In Stock |
|
| 500G | RMB356.00 | In Stock |
|
| 2.5kg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -70°C |
| Boiling point: | 215-228 °C4 mm Hg(lit.) |
| Density | 1.006 g/mL at 25 °C(lit.) |
| vapor density | 13.7 (vs air) |
| vapor pressure | 0.03 mm Hg ( 150 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store at -20°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to very slightly yellow |
| Water Solubility | Soluble |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C18H39O7P/c1-4-7-10-20-13-16-23-26(19,24-17-14-21-11-8-5-2)25-18-15-22-12-9-6-3/h4-18H2,1-3H3 |
| InChIKey | WTLBZVNBAKMVDP-UHFFFAOYSA-N |
| SMILES | CCCCOCCOP(=O)(OCCOCCCC)OCCOCCCC |
| LogP | 3.75 at 20℃ |
| CAS DataBase Reference | 78-51-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Phosphoric acid, tri-(2-butoxyethyl) ester(78-51-3) |
| EPA Substance Registry System | Tris(2-butoxyethyl) phosphate (78-51-3) |
| ECETOC JACC REPORT | Tris(2-butoxyethyl) phosphate (78-51-3) |
Description and Uses
Primary plasticizer for most resins and elastomers, floor finishes and waxes, flame-retarding agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 1 |
| RTECS | KJ9800000 |
| TSCA | TSCA listed |
| HS Code | 29199000 |
| Storage Class | 10 - Combustible liquids |
| Hazardous Substances Data | 78-51-3(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 3gm/kg |







