PRODUCT Properties
| Melting point: | -25 °C |
| Boiling point: | 410 °C |
| Density | 1.2 |
| vapor pressure | 0.195 at 50 °C (Carré and Bertrans, 1998) |
| refractive index | 1.558-1.561 |
| Flash point: | 225 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | sparingly soluble in water; soluble in acetic acid; freely soluble in
alcohol, benzene, ether; very soluble in carbon tetrachloride, toluene. maximum allowable concentration: 0.1 mg/m3 (TLV-TWA) (ACGIH 1986) |
| form | Viscous Liquid |
| color | Clear colorless to yellow |
| Specific Heat Capacity | Cp(crystal): 1.57 J/(g·K), at 25℃ |
| Merck | 14,9764 |
| Henry's Law Constant | 5.2×100 mol/(m3Pa) at 25℃, HSDB (2015) |
| Exposure limits | ACGIH:TLV-TWA 0.02 mg/m3,Inhalable fraction,and vapor OSHA:PEL-TWA 0.1 mg/m3 NIOSH:REL-TWA 0.1 mg/m3 |
| Major Application | environmental |
| InChI | 1S/C21H21O4P/c1-16-10-4-7-13-19(16)23-26(22,24-20-14-8-5-11-17(20)2)25-21-15-9-6-12-18(21)3/h4-15H,1-3H3 |
| InChIKey | YSMRWXYRXBRSND-UHFFFAOYSA-N |
| SMILES | O=P(OC1=C(C)C=CC=C1)(OC2=C(C)C=CC=C2)OC3=CC=CC=C3C |
| CAS DataBase Reference | 78-30-8(CAS DataBase Reference) |
| EPA Substance Registry System | Tri-o-cresyl phosphate (78-30-8) |
Description and Uses
TOCP finds wide applications in several areas. It is used as a flame retardant; as a plasticizer; as a waterproofing agent; as a synthetic lubricant; as an additive in gasoline to control preignition; and in hot extrusion molding, hydraulic fluid, and solvent mixture for resins..
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H370-H411 |
| Precautionary statements | P260-P264-P270-P307+P311-P321-P405-P501 |
| Hazard Codes | N-T,N,T |
| Risk Statements | 51/53-39/23/24/25 |
| Safety Statements | 61-45-28A-20/21-28 |
| RIDADR | 3082 |
| OEB | D |
| OEL | TWA: 0.1 mg/m3 [skin] |
| WGK Germany | WGK 3 |
| RTECS | TD0350000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29199000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 STOT SE 1 |
| Hazardous Substances Data | 78-30-8(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for rats 160 mg/kg (quoted, RTECS, 1985). |
| IDLA | 40 mg/m3 |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








