A3432512
Diphenyl phosphite , 4712-55-4
Synonym(s):
Diphenoxyphosphine oxide;Diphenyl phosphonate;NSC 43786
CAS NO.:4712-55-4
Empirical Formula: C12H11O3P
Molecular Weight: 234.19
MDL number: MFCD00044497
EINECS: 225-202-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB72.80 | In Stock |
|
| 100G | RMB159.20 | In Stock |
|
| 500G | RMB423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 12 °C (lit.) |
| Boiling point: | 218-219 °C/26 mmHg (lit.) |
| Density | 1.223 g/mL at 25 °C (lit.) |
| vapor density | 8.1 (vs air) |
| vapor pressure | 5 mm Hg ( 140 °C) |
| refractive index | n |
| Flash point: | 350 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid |
| color | Clear |
| Specific Gravity | 1.223 |
| BRN | 2051909 |
| InChI | 1S/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
| InChIKey | OGBPILLJZSJJRC-UHFFFAOYSA-N |
| SMILES | O=[PH](Oc1ccccc1)Oc2ccccc2 |
| LogP | 2.4 at 25℃ and pH7 |
| CAS DataBase Reference | 4712-55-4(CAS DataBase Reference) |
| EPA Substance Registry System | Diphenyl phosphite (4712-55-4) |
Description and Uses
Diphenyl Phosphite is a reactant used in the synthesis of α-hydroxyphosphonates and α-hydroxyphosphinates for their antioxidant and antimicrobial activity.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | 1760 |
| WGK Germany | 3 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29209090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








