A0723712
Ammonium nitrate -<sup>15</sup>N , Pack: 10ATOM%; Chemical purity: ≥98.5% , 31432-46-9
Synonym(s):
15N ammonium salt;15N labeled ammonium nitrate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB161.60 | In Stock |
|
| 5g | RMB561.60 | In Stock |
|
| 25G | RMB2239.20 | In Stock |
|
| 100G | RMB8079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169 °C (lit.) |
| Boiling point: | 210 °C (lit.) |
| form | solid |
| InChI | InChI=1S/HNO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3/i1+1; |
| InChIKey | PRORZGWHZXZQMV-YTBWXGASSA-N |
| SMILES | [15N+]([O-])(=O)O.N |
| CAS Number Unlabeled | 6484-52-2 |
Description and Uses
Ammonium nitrate-15N is a commonly used compound in agriculture research as a tracer.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Warning |
| Hazard statements | H272-H315-H319-H335 |
| Precautionary statements | P210-P220-P261-P264-P302+P352-P305+P351+P338 |
| Hazard Codes | O,Xi |
| Risk Statements | 8-36/37/38 |
| Safety Statements | 17-26-36 |
| RIDADR | UN 1942 5.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 28459000 |
| Storage Class | 5.1C - Ammonium nitrate and ammonium nitrate containing preparations |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 3 |






