A0723912
Ammonium nitrate -15N2 , Pack: 10ATOM%; Chemical purity: ≥98.5% , 43086-60-8
Synonym(s):
Ammonium-15N nitrate-15N
| Pack Size | Price | Stock | Quantity |
| 1G | RMB239.20 | In Stock |
|
| 5G | RMB1119.20 | In Stock |
|
| 25G | RMB5039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169 °C(lit.) |
| Boiling point: | 201 °C(lit.) |
| form | solid |
| InChI | InChI=1S/HNO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3/i2*1+1 |
| InChIKey | PRORZGWHZXZQMV-NPMJFZSBSA-N |
| SMILES | [15N+]([O-])(=O)O.[15NH3] |
| CAS Number Unlabeled | 6484-52-2 |
| CAS Number Unlabeled | 6484-52-2 |
| CAS Number Unlabeled | 6484-52-2 |
Description and Uses
Ammonium nitrate-15N2 has been used for
- Metabolic labeling of plants for quantitative plant proteomic experiments.
- Identifying specific compounds within mixtures of thousands of metabolites in biological extracts using mass spectrometry.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Warning |
| Hazard statements | H272-H315-H319-H335 |
| Precautionary statements | P210-P220-P261-P264-P302+P352-P305+P351+P338 |
| Hazard Codes | O,Xi |
| Risk Statements | 7-36/37/38-8 |
| Safety Statements | 3-7-14-26-36/37/39-36-17 |
| RIDADR | UN 1942 5.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 28459000 |






