PRODUCT Properties
| Melting point: | >300 °C (dec.)(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Aqueous Acid (Slightly) |
| form | Solid |
| color | Off-White |
| optical activity | [α]25/D +25.0°, c = 2 in 5 M HCl |
| Stability: | Hygroscopic |
| InChI | 1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i5+1 |
| InChIKey | CKLJMWTZIZZHCS-KPHKZEKTSA-N |
| SMILES | [15NH2][C@@H](CC(O)=O)C(O)=O |
| CAS Number Unlabeled | 56-84-8 |
Description and Uses
L-Aspartic Acid-15N is labelled L-Aspartic Acid (A790024), a non-essential amino acid found in food sources. L-Aspartic Acid is one of the 20 proteinogenic amino acids; the building blocks of proteins. Its conjugate base L-aspartate is an excitatory neurotransmitter in the central nervous system.



