A0727112
(Acetylacetonato)dicarbonylrhodium(I) , 99% , 14874-82-9
Synonym(s):
(Acetylacetonato)dicarbonylrhodium(I);Dicarbonyl-acetylacetonato-rhodium(I);Dicarbonylrhodium(I) 2,4-pentanedionate;Rh(CO)2acac;Rhodium(I) dicarbonyl acetylacetonate
CAS NO.：14874-82-9
Empirical Formula: C7H7O4Rh
Molecular Weight: 258.03
MDL number: MFCD00009884
EINECS: 238-947-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB2159.20 | In Stock |
|
| 500MG | RMB3439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-156 °C (lit.) |
| Density | 1.96[at 20℃] |
| vapor pressure | 0.13Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in acetone |
| form | Needles or Flakes |
| color | Greenish-red |
| Water Solubility | insoluble |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 0.1 mg/m3 |
| InChI | InChI=1S/C5H7O2.2CO.Rh/c1-4(6)3-5(2)7;2*1-2;/h3H,1-2H3;;;/q-1;;;+1 |
| InChIKey | QKXHARLOMLGJCF-UHFFFAOYSA-N |
| SMILES | C([Rh+]1(O=C(C)[CH-]C(C)=O1)C#O)#O |
| LogP | 0.4 at 20℃ |
| NIST Chemistry Reference | Rhodium, dicarbonyl(2,4-pentanedionato-o,o')-, (sp-4-2)-(14874-82-9) |
| EPA Substance Registry System | Rhodium, dicarbonyl(2,4-pentanedionato-.kappa.O2,.kappa.O4)-, (SP-4-2)- (14874-82-9) |
Description and Uses
Umicore Precatalysts for Asymmetric and Cross-Coupling Catalysis
Catalyst for various carbonylation reactions, silylcarbocyclizations,conjugate additions to enones, carbamoylstannation,and reduction of aromatic nitro compounds
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H317-H319 |
| Precautionary statements | P210-P240-P241-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F,T |
| Risk Statements | 36/37/38-44-43-25 |
| Safety Statements | 26-37/39-45-36/37/39-24/25 |
| RIDADR | 3282 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28439000 |
