A0734412
2-Amino-6-bromopyridine , 98% , 19798-81-3
CAS NO.:19798-81-3
Empirical Formula: C5H5BrN2
Molecular Weight: 173.01
MDL number: MFCD00137843
EINECS: 606-385-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB133.60 | In Stock |
|
| 100G | RMB509.60 | In Stock |
|
| 500g | RMB1791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-91 °C (lit.) |
| Boiling point: | 273.0±20.0 °C(Predicted) |
| Density | 1.710±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Very Slightly) |
| form | Powder |
| pka | 2.73±0.24(Predicted) |
| color | Slightly yellow to light brown |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C5H5BrN2/c6-4-2-1-3-5(7)8-4/h1-3H,(H2,7,8) |
| InChIKey | BKLJUYPLUWUEOQ-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(Br)=CC=C1 |
| CAS DataBase Reference | 19798-81-3(CAS DataBase Reference) |
Description and Uses
2-Amino-6-bromopyridine is a disubstituted pyridine used as a building block in the preparation of nitrogen containing bicyclic and polycylic compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






