A0737912
4-Amino-3-(trifluoromethyl)benzonitrile , 98% , 327-74-2
CAS NO.：327-74-2
Empirical Formula: C8H5F3N2
Molecular Weight: 186.13
MDL number: MFCD00275473
EINECS: 675-039-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB280.00 | In Stock |
|
| 100G | RMB781.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-63°C |
| Boiling point: | 100°C 0,1mm |
| Density | 1.37±0.1 g/cm3(Predicted) |
| Flash point: | 100°C/0.1mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -1.41±0.10(Predicted) |
| color | White to Light Beige |
| BRN | 2970379 |
| InChI | InChI=1S/C8H5F3N2/c9-8(10,11)6-3-5(4-12)1-2-7(6)13/h1-3H,13H2 |
| InChIKey | MWLZJOBGDXBMBP-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N)C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 327-74-2(CAS DataBase Reference) |
Description and Uses
2-Amino-5-cyanobenzotrifluoride is used in the design and synthesis of 4-phenylpyrrole derivatives as androgen receptor antagonists which show efficacy against prostate cancer cells.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H302-H312-H331-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501-P304+P340-P305+P351+P338-P501a |
| Hazard Codes | Xi,T |
| Risk Statements | 23/24/25-36/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3439 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
