A0738912
2-(1-Adamantyl)-4-bromoanisole , 98% , 104224-63-7
CAS NO.：104224-63-7
Empirical Formula: C17H21BrO
Molecular Weight: 321.25
MDL number: MFCD03855308
EINECS: 689-408-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB64.00 | In Stock |
|
| 25G | RMB234.40 | In Stock |
|
| 100G | RMB778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-141°C |
| Boiling point: | 402.5±38.0 °C(Predicted) |
| Density | 1.346±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White |
| InChI | InChI=1S/C17H21BrO/c1-19-16-3-2-14(18)7-15(16)17-8-11-4-12(9-17)6-13(5-11)10-17/h2-3,7,11-13H,4-6,8-10H2,1H3 |
| InChIKey | QQAMHHZQONQBFZ-UHFFFAOYSA-N |
| SMILES | C12(C3=CC(Br)=CC=C3OC)CC3CC(CC(C3)C1)C2 |
| CAS DataBase Reference | 104224-63-7(CAS DataBase Reference) |
Description and Uses
1-(5-Bromo-2-methoxy-phenyl)adamantane is an organic synthesis reagent for the preparation of the adapalene intermediate 6-bromo-2-naphthalenecarboxylate.
Adapalene (A225000) impurity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2909309090 |
