A0739812
3-Amino-4-methylbenzeneboronic acid , 98% , 22237-12-3
CAS NO.：22237-12-3
Empirical Formula: C7H10BNO2
Molecular Weight: 150.97
MDL number: MFCD01632201
EINECS: 681-828-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB127.20 | In Stock |
|
| 5G | RMB589.60 | In Stock |
|
| 25G | RMB2012.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250°C |
| Boiling point: | 367.6±52.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystaline |
| pka | 8.77±0.10(Predicted) |
| color | White to Gray to Brown |
| InChI | InChI=1S/C7H10BNO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,10-11H,9H2,1H3 |
| InChIKey | PLTGUDDQNWJILD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C)C(N)=C1)(O)O |
| CAS DataBase Reference | 22237-12-3(CAS DataBase Reference) |
Description and Uses
3-Amino-4-methylphenylboronic acid, HCl
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
