A0742212
(R)-(+)-alpha,alpha-Diphenylprolinol , 99% , 22348-32-9
Synonym(s):
α,α-Diphenyl-D -prolinol;(R)-2-(Diphenylhydroxymethyl)pyrrolidine
CAS NO.:22348-32-9
Empirical Formula: C17H19NO
Molecular Weight: 253.35
MDL number: MFCD00077754
EINECS: 606-992-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB19.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB480.00 | In Stock |
|
| 500g | RMB2282.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-80 °C |
| alpha | 59 º (589nm, c=3, MeOH 25 ºC) |
| Boiling point: | 396.54°C (rough estimate) |
| Density | 1.0078 (rough estimate) |
| refractive index | 58 ° (C=2, MeOH) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | almost transparency in Chloroform |
| form | solid |
| pka | 13.15±0.29(Predicted) |
| color | white to off-white |
| optical activity | [α]20/D +69°, c = 3 in chloroform |
| BRN | 4353363 |
| InChI | 1S/C17H19NO/c19-17(16-12-7-13-18-16,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16,18-19H,7,12-13H2/t16-/m1/s1 |
| InChIKey | OGCGXUGBDJGFFY-MRXNPFEDSA-N |
| SMILES | OC([C@H]1CCCN1)(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 22348-32-9(CAS DataBase Reference) |
| NIST Chemistry Reference | (R)-alpha-(2-pyrrolidinyl)benzhydryl alcohol(22348-32-9) |
Description and Uses
Used to prepare the corresponding oxazaborolidines for the borane-mediated asymmetric reduction of ketones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10-34 |
| TSCA | No |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






