A0742812
Isoluminol , 98% , 3682-14-2
Synonym(s):
6-Amino-2,3-dihydro-1,4-phthalazinedione;Isoluminol
| Pack Size | Price | Stock | Quantity |
| 1G | RMB262.40 | In Stock |
|
| 5G | RMB814.40 | In Stock |
|
| 10g | RMB1279.20 | In Stock |
|
| 25G | RMB2364.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C (lit.) |
| Density | 1.433±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in ammonium hydroxide, sodium carbonate or other base. |
| pka | 10.78±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Sensitive | Air Sensitive |
| BRN | 164804 |
| InChI | InChI=1S/C8H7N3O2/c9-4-1-2-5-6(3-4)8(13)11-10-7(5)12/h1-3H,9H2,(H,10,12)(H,11,13) |
| InChIKey | HUDPLKWXRLNSPC-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC(N)=C2)C(O)=NN1 |
| CAS DataBase Reference | 3682-14-2(CAS DataBase Reference) |
Description and Uses
4-Aminophthalhydrazide has been used in:
- chemiluminescence-based reactive oxygen species (ROS) assay in bone marrow (BM) neutrophils post-Yersinia pseudotuberculosis infection
- neutrophil ROS assays post-K. pneumonia exposure
- neutrophil ROS assays in response to formylated-methionine-leucine-proline
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





